C16H17Br4NO — CID 4513022
6-bromo-N-(2-bromophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide (PubChem CID 4513022) has the molecular formula C16H17Br4NO and a molecular weight of 558.93 g/mol. Its IUPAC name is 6-bromo-N-(2-bromophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide.
| Compound Name | 6-bromo-N-(2-bromophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
|---|---|
| PubChem CID | 4513022 |
| Molecular Formula | C16H17Br4NO |
| Molecular Weight | 558.93 g/mol |
| Exact Mass | 554.80 |
| IUPAC Name | 6-bromo-N-(2-bromophenyl)-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carboxamide |
| SMILES | CC1(C)C2(C(=O)Nc3ccccc3Br)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C16H17Br4NO/c1-14(2)15(12(19)20)7-8-16(14,11(15)18)13(22)21-10-6-4-3-5-9(10)17/h3-6,11-12H,7-8H2,1-2H3,(H,21,22) |
| InChIKey | UGHMDNWDHHKOQZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.93 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|