C24H27BrN2O2 — CID 4728227
6-bromo-N'-(2,2-diphenylacetyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carbohydrazide (PubChem CID 4728227) has the molecular formula C24H27BrN2O2 and a molecular weight of 455.40 g/mol. Its IUPAC name is 6-bromo-N'-(2,2-diphenylacetyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carbohydrazide.
| Compound Name | 6-bromo-N'-(2,2-diphenylacetyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
|---|---|
| PubChem CID | 4728227 |
| Molecular Formula | C24H27BrN2O2 |
| Molecular Weight | 455.40 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 6-bromo-N'-(2,2-diphenylacetyl)-4,5,5-trimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
| SMILES | CC12CCC(C(=O)NNC(=O)C(c3ccccc3)c3ccccc3)(C1Br)C2(C)C |
| InChI | InChI=1S/C24H27BrN2O2/c1-22(2)23(3)14-15-24(22,20(23)25)21(29)27-26-19(28)18(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13,18,20H,14-15H2,1-3H3,(H,26,28)(H,27,29) |
| InChIKey | RXLDNHAVEWDMFJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|