C16H19Br3N2O3S — CID 4728146
N'-(benzenesulfonyl)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide (PubChem CID 4728146) has the molecular formula C16H19Br3N2O3S and a molecular weight of 559.12 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide.
| Compound Name | N'-(benzenesulfonyl)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
|---|---|
| PubChem CID | 4728146 |
| Molecular Formula | C16H19Br3N2O3S |
| Molecular Weight | 559.12 g/mol |
| Exact Mass | 555.87 |
| IUPAC Name | N'-(benzenesulfonyl)-6-bromo-4-(dibromomethyl)-5,5-dimethylbicyclo[2.1.1]hexane-1-carbohydrazide |
| SMILES | CC1(C)C2(C(=O)NNS(=O)(=O)c3ccccc3)CCC1(C(Br)Br)C2Br |
| InChI | InChI=1S/C16H19Br3N2O3S/c1-14(2)15(12(18)19)8-9-16(14,11(15)17)13(22)20-21-25(23,24)10-6-4-3-5-7-10/h3-7,11-12,21H,8-9H2,1-2H3,(H,20,22) |
| InChIKey | YGJNMPGDIIPYBC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.12 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|