About N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen
N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen (PubChem CID 142366581) has the molecular formula C14H25N3O3S
and a molecular weight of 315.44 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen.
Molecular Properties
| Compound Name | N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen |
| PubChem CID | 142366581 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen |
| SMILES | CC1CCCC(C)N1C(=O)NNS(=O)(=O)c1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C14H21N3O3S.2H2/c1-11-7-6-8-12(2)17(11)14(18)15-16-21(19,20)13-9-4-3-5-10-13;;/h3-5,9-12,16H,6-8H2,1-2H3,(H,15,18);2*1H |
| InChIKey | ODKCZTJKFWMVKK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen?
The IUPAC name of N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen (CID 142366581) is N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen.
What is the SMILES notation for N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen?
The canonical SMILES for N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen is CC1CCCC(C)N1C(=O)NNS(=O)(=O)c1ccccc1.[H][H].[H][H].
What is the InChIKey of N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen?
The InChIKey is ODKCZTJKFWMVKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O3S.2H2/c1-11-7-6-8-12(2)17(11)14(18)15-16-21(19,20)13-9-4-3-5-10-13;;/h3-5,9-12,16H,6-8H2,1-2H3,(H,15,18);2*1H.
What are the key properties of N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen?
N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen has a molecular weight of 315.44 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen is sourced from PubChem (CID 142366581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).