C14H25N3O3S — CID 142366581
N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen (PubChem CID 142366581) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen.
| Compound Name | N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen |
|---|---|
| PubChem CID | 142366581 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | N'-(benzenesulfonyl)-2,6-dimethylpiperidine-1-carbohydrazide;molecular hydrogen |
| SMILES | CC1CCCC(C)N1C(=O)NNS(=O)(=O)c1ccccc1.[H][H].[H][H] |
| InChI | InChI=1S/C14H21N3O3S.2H2/c1-11-7-6-8-12(2)17(11)14(18)15-16-21(19,20)13-9-4-3-5-10-13;;/h3-5,9-12,16H,6-8H2,1-2H3,(H,15,18);2*1H |
| InChIKey | ODKCZTJKFWMVKK-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|