C17H27BrN2O2 — CID 11863746
(1S,3R,4R)-3-bromo-4-(4-ethylpiperazine-1-carbonyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 11863746) has the molecular formula C17H27BrN2O2 and a molecular weight of 371.32 g/mol. Its IUPAC name is (1S,3R,4R)-3-bromo-4-(4-ethylpiperazine-1-carbonyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3R,4R)-3-bromo-4-(4-ethylpiperazine-1-carbonyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 11863746 |
| Molecular Formula | C17H27BrN2O2 |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | (1S,3R,4R)-3-bromo-4-(4-ethylpiperazine-1-carbonyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CCN1CCN(C(=O)[C@]23CC[C@](C)(C(=O)[C@@H]2Br)C3(C)C)CC1 |
| InChI | InChI=1S/C17H27BrN2O2/c1-5-19-8-10-20(11-9-19)14(22)17-7-6-16(4,15(17,2)3)13(21)12(17)18/h12H,5-11H2,1-4H3/t12-,16+,17-/m0/s1 |
| InChIKey | DHRDDRIHTXQAJH-VUCTXSBTSA-N |
| XLogP | 2.31 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|