C16H26N2O2 — CID 50898143
(1S,4R)-1-(4-ethylpiperazine-1-carbonyl)-3,3-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 50898143) has the molecular formula C16H26N2O2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (1S,4R)-1-(4-ethylpiperazine-1-carbonyl)-3,3-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4R)-1-(4-ethylpiperazine-1-carbonyl)-3,3-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 50898143 |
| Molecular Formula | C16H26N2O2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | (1S,4R)-1-(4-ethylpiperazine-1-carbonyl)-3,3-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CCN1CCN(C(=O)[C@@]23CC[C@H](C2)C(C)(C)C3=O)CC1 |
| InChI | InChI=1S/C16H26N2O2/c1-4-17-7-9-18(10-8-17)14(20)16-6-5-12(11-16)15(2,3)13(16)19/h12H,4-11H2,1-3H3/t12-,16+/m1/s1 |
| InChIKey | VFJJJVGGFJRUCE-WBMJQRKESA-N |
| XLogP | 1.55 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|