C17H27BrN2O3 — CID 4861696
3-bromo-4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 4861696) has the molecular formula C17H27BrN2O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is 3-bromo-4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | 3-bromo-4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 4861696 |
| Molecular Formula | C17H27BrN2O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 386.12 |
| IUPAC Name | 3-bromo-4-[4-(2-hydroxyethyl)piperazine-1-carbonyl]-1,7,7-trimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | CC12CCC(C(=O)N3CCN(CCO)CC3)(C(Br)C1=O)C2(C)C |
| InChI | InChI=1S/C17H27BrN2O3/c1-15(2)16(3)4-5-17(15,12(18)13(16)22)14(23)20-8-6-19(7-9-20)10-11-21/h12,21H,4-11H2,1-3H3 |
| InChIKey | SUISPSXVNDPQGC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|