C21H27BrO3 — CID 4861744
(5-methyl-2-propan-2-ylphenyl) 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 4861744) has the molecular formula C21H27BrO3 and a molecular weight of 407.35 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 4861744 |
| Molecular Formula | C21H27BrO3 |
| Molecular Weight | 407.35 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 2-bromo-4,7,7-trimethyl-3-oxobicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C23CCC(C)(C(=O)C2Br)C3(C)C)c1 |
| InChI | InChI=1S/C21H27BrO3/c1-12(2)14-8-7-13(3)11-15(14)25-18(24)21-10-9-20(6,19(21,4)5)17(23)16(21)22/h7-8,11-12,16H,9-10H2,1-6H3 |
| InChIKey | NAMGOOGKOHKHLO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|