C16H22O2 — CID 137492386
(5-methyl-2-propan-2-ylphenyl) 2,2-dimethylcyclopropane-1-carboxylate (PubChem CID 137492386) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (5-methyl-2-propan-2-ylphenyl) 2,2-dimethylcyclopropane-1-carboxylate.
| Compound Name | (5-methyl-2-propan-2-ylphenyl) 2,2-dimethylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 137492386 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (5-methyl-2-propan-2-ylphenyl) 2,2-dimethylcyclopropane-1-carboxylate |
| SMILES | Cc1ccc(C(C)C)c(OC(=O)C2CC2(C)C)c1 |
| InChI | InChI=1S/C16H22O2/c1-10(2)12-7-6-11(3)8-14(12)18-15(17)13-9-16(13,4)5/h6-8,10,13H,9H2,1-5H3 |
| InChIKey | UJGZNRFPJKTSFO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|