C12H12Cl2O2 — CID 78773356
(2,4-dimethylphenyl) 2,2-dichlorocyclopropane-1-carboxylate (PubChem CID 78773356) has the molecular formula C12H12Cl2O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is (2,4-dimethylphenyl) 2,2-dichlorocyclopropane-1-carboxylate.
| Compound Name | (2,4-dimethylphenyl) 2,2-dichlorocyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 78773356 |
| Molecular Formula | C12H12Cl2O2 |
| Molecular Weight | 259.13 g/mol |
| Exact Mass | 258.02 |
| IUPAC Name | (2,4-dimethylphenyl) 2,2-dichlorocyclopropane-1-carboxylate |
| SMILES | Cc1ccc(OC(=O)C2CC2(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C12H12Cl2O2/c1-7-3-4-10(8(2)5-7)16-11(15)9-6-12(9,13)14/h3-5,9H,6H2,1-2H3 |
| InChIKey | IGTVERXYDPUXJE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.13 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|