C16H26BrN2O2+ — CID 7124022
(1S,3S,4R)-3-bromo-1,7,7-trimethyl-4-(4-methylpiperazin-4-ium-1-carbonyl)bicyclo[2.2.1]heptan-2-one (PubChem CID 7124022) has the molecular formula C16H26BrN2O2+ and a molecular weight of 358.30 g/mol. Its IUPAC name is (1S,3S,4R)-3-bromo-1,7,7-trimethyl-4-(4-methylpiperazin-4-ium-1-carbonyl)bicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,3S,4R)-3-bromo-1,7,7-trimethyl-4-(4-methylpiperazin-4-ium-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 7124022 |
| Molecular Formula | C16H26BrN2O2+ |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (1S,3S,4R)-3-bromo-1,7,7-trimethyl-4-(4-methylpiperazin-4-ium-1-carbonyl)bicyclo[2.2.1]heptan-2-one |
| SMILES | C[NH+]1CCN(C(=O)[C@]23CC[C@](C)(C(=O)[C@H]2Br)C3(C)C)CC1 |
| InChI | InChI=1S/C16H25BrN2O2/c1-14(2)15(3)5-6-16(14,11(17)12(15)20)13(21)19-9-7-18(4)8-10-19/h11H,5-10H2,1-4H3/p+1/t11-,15-,16+/m1/s1 |
| InChIKey | MYLKLBIVJDZYHM-LYRGGWFBSA-O |
| XLogP | 0.50 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|