C20H28NO+ — CID 54524288
[1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-2-phenylethenyl]-trimethylazanium (PubChem CID 54524288) has the molecular formula C20H28NO+ and a molecular weight of 298.45 g/mol. Its IUPAC name is [1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-2-phenylethenyl]-trimethylazanium.
| Compound Name | [1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-2-phenylethenyl]-trimethylazanium |
|---|---|
| PubChem CID | 54524288 |
| Molecular Formula | C20H28NO+ |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | [1-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)-2-phenylethenyl]-trimethylazanium |
| SMILES | CC1(C)C2CCC1(C(=Cc1ccccc1)[N+](C)(C)C)C(=O)C2 |
| InChI | InChI=1S/C20H28NO/c1-19(2)16-11-12-20(19,18(22)14-16)17(21(3,4)5)13-15-9-7-6-8-10-15/h6-10,13,16H,11-12,14H2,1-5H3/q+1 |
| InChIKey | YSAHRDXGDPWTLD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|