C22H26O3 — CID 88643387
methyl (E)-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylidene]-3-methyl-4-phenylbut-3-enoate (PubChem CID 88643387) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is methyl (E)-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylidene]-3-methyl-4-phenylbut-3-enoate.
| Compound Name | methyl (E)-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylidene]-3-methyl-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 88643387 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | methyl (E)-2-[(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)methylidene]-3-methyl-4-phenylbut-3-enoate |
| SMILES | COC(=O)C(=CC12CCC(CC1=O)C2(C)C)/C(C)=C/c1ccccc1 |
| InChI | InChI=1S/C22H26O3/c1-15(12-16-8-6-5-7-9-16)18(20(24)25-4)14-22-11-10-17(13-19(22)23)21(22,2)3/h5-9,12,14,17H,10-11,13H2,1-4H3/b15-12+,18-14? |
| InChIKey | IGOLOOPWAFSKJT-AOTOKVBWSA-N |
| XLogP | 4.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|