C11H16O — CID 11084219
(1S,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one (PubChem CID 11084219) has the molecular formula C11H16O and a molecular weight of 164.25 g/mol. Its IUPAC name is (1S,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one.
| Compound Name | (1S,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
|---|---|
| PubChem CID | 11084219 |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.12 |
| IUPAC Name | (1S,4R)-1-ethenyl-7,7-dimethylbicyclo[2.2.1]heptan-2-one |
| SMILES | C=C[C@]12CC[C@H](CC1=O)C2(C)C |
| InChI | InChI=1S/C11H16O/c1-4-11-6-5-8(7-9(11)12)10(11,2)3/h4,8H,1,5-7H2,2-3H3/t8-,11+/m1/s1 |
| InChIKey | UEVFTEJYOXJPNL-KCJUWKMLSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|