About 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate
1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate (PubChem CID 67127401) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate |
| PubChem CID | 67127401 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate |
| SMILES | COC(=Cc1ccccc1)C(=O)OC12CCC(CC1)C2 |
| InChI | InChI=1S/C17H20O3/c1-19-15(11-13-5-3-2-4-6-13)16(18)20-17-9-7-14(12-17)8-10-17/h2-6,11,14H,7-10,12H2,1H3 |
| InChIKey | UJJVWLBJNDUSIU-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate?
The IUPAC name of 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate (CID 67127401) is 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate.
What is the SMILES notation for 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate?
The canonical SMILES for 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate is COC(=Cc1ccccc1)C(=O)OC12CCC(CC1)C2.
What is the InChIKey of 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate?
The InChIKey is UJJVWLBJNDUSIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3/c1-19-15(11-13-5-3-2-4-6-13)16(18)20-17-9-7-14(12-17)8-10-17/h2-6,11,14H,7-10,12H2,1H3.
What are the key properties of 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate?
1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate has a molecular weight of 272.34 g/mol, XLogP of 3.55, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bicyclo[2.2.1]heptanyl 2-methoxy-3-phenylprop-2-enoate is sourced from PubChem (CID 67127401), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).