C10H14NO3- — CID 23309790
(1S,2Z,4S)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23309790) has the molecular formula C10H14NO3- and a molecular weight of 196.23 g/mol. Its IUPAC name is (1S,2Z,4S)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | (1S,2Z,4S)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 23309790 |
| Molecular Formula | C10H14NO3- |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | (1S,2Z,4S)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C(=O)[O-])/C(=N\O)C2 |
| InChI | InChI=1S/C10H15NO3/c1-9(2)6-3-4-10(9,8(12)13)7(5-6)11-14/h6,14H,3-5H2,1-2H3,(H,12,13)/p-1/b11-7-/t6-,10-/m0/s1 |
| InChIKey | RUXKABJRHSLBTR-DINUDXAQSA-M |
| XLogP | 0.39 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|