C10H14KNO3 — CID 23670975
potassium (2E)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 23670975) has the molecular formula C10H14KNO3 and a molecular weight of 235.32 g/mol. Its IUPAC name is potassium (2E)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | potassium (2E)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 23670975 |
| Molecular Formula | C10H14KNO3 |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | potassium (2E)-2-hydroxyimino-7,7-dimethylbicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | CC1(C)C2CCC1(C(=O)[O-])/C(=N/O)C2.[K+] |
| InChI | InChI=1S/C10H15NO3.K/c1-9(2)6-3-4-10(9,8(12)13)7(5-6)11-14;/h6,14H,3-5H2,1-2H3,(H,12,13);/q;+1/p-1/b11-7+; |
| InChIKey | QJPGTIUCIRYYRU-RVDQCCQOSA-M |
| XLogP | -2.60 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|