C16H20N2O2 — CID 101431000
(1S,4R)-7,7-dimethyl-2-(pyridin-2-ylmethylimino)bicyclo[2.2.1]heptane-1-carboxylic acid (PubChem CID 101431000) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is (1S,4R)-7,7-dimethyl-2-(pyridin-2-ylmethylimino)bicyclo[2.2.1]heptane-1-carboxylic acid.
| Compound Name | (1S,4R)-7,7-dimethyl-2-(pyridin-2-ylmethylimino)bicyclo[2.2.1]heptane-1-carboxylic acid |
|---|---|
| PubChem CID | 101431000 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | (1S,4R)-7,7-dimethyl-2-(pyridin-2-ylmethylimino)bicyclo[2.2.1]heptane-1-carboxylic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C(=O)O)/C(=N/Cc1ccccn1)C2 |
| InChI | InChI=1S/C16H20N2O2/c1-15(2)11-6-7-16(15,14(19)20)13(9-11)18-10-12-5-3-4-8-17-12/h3-5,8,11H,6-7,9-10H2,1-2H3,(H,19,20)/b18-13+/t11-,16+/m1/s1 |
| InChIKey | ASDOJZOVDBSVMX-OTMQTTBBSA-N |
| XLogP | 2.93 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|