C32H46N4 — CID 159041720
(1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine;(1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-imine (PubChem CID 159041720) has the molecular formula C32H46N4 and a molecular weight of 486.75 g/mol. Its IUPAC name is (1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine;(1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine;(1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 159041720 |
| Molecular Formula | C32H46N4 |
| Molecular Weight | 486.75 g/mol |
| Exact Mass | 486.37 |
| IUPAC Name | (1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-amine;(1R)-1,7,7-trimethyl-N-(pyridin-2-ylmethyl)bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC1(C)C2CC[C@@]1(C)/C(=N/Cc1ccccn1)C2.CC1(C)C2CC[C@@]1(C)C(NCc1ccccn1)C2 |
| InChI | InChI=1S/C16H24N2.C16H22N2/c2*1-15(2)12-7-8-16(15,3)14(10-12)18-11-13-6-4-5-9-17-13/h4-6,9,12,14,18H,7-8,10-11H2,1-3H3;4-6,9,12H,7-8,10-11H2,1-3H3/b;18-14+/t12?,14?,16-;12?,16-/m00/s1 |
| InChIKey | JWDHERQSTHJKOQ-OVTSXLITSA-N |
| XLogP | 7.25 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.75 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|