C18H26N2 — CID 102228854
(1R)-1,7,7-trimethyl-N-(2-pyridin-2-ylpropan-2-yl)bicyclo[2.2.1]heptan-2-imine (PubChem CID 102228854) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is (1R)-1,7,7-trimethyl-N-(2-pyridin-2-ylpropan-2-yl)bicyclo[2.2.1]heptan-2-imine.
| Compound Name | (1R)-1,7,7-trimethyl-N-(2-pyridin-2-ylpropan-2-yl)bicyclo[2.2.1]heptan-2-imine |
|---|---|
| PubChem CID | 102228854 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | (1R)-1,7,7-trimethyl-N-(2-pyridin-2-ylpropan-2-yl)bicyclo[2.2.1]heptan-2-imine |
| SMILES | CC(C)(/N=C1\CC2CC[C@]1(C)C2(C)C)c1ccccn1 |
| InChI | InChI=1S/C18H26N2/c1-16(2)13-9-10-18(16,5)15(12-13)20-17(3,4)14-8-6-7-11-19-14/h6-8,11,13H,9-10,12H2,1-5H3/b20-15+/t13?,18-/m0/s1 |
| InChIKey | WSFFFKFMSQXLPF-RIFUXQLRSA-N |
| XLogP | 4.60 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|