C12H22N2 — CID 23308484
N-methyl-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methanamine (PubChem CID 23308484) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is N-methyl-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methanamine.
| Compound Name | N-methyl-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methanamine |
|---|---|
| PubChem CID | 23308484 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-methyl-N-[(Z)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]methanamine |
| SMILES | CN(C)/N=C1/C[C@H]2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C12H22N2/c1-11(2)9-6-7-12(11,3)10(8-9)13-14(4)5/h9H,6-8H2,1-5H3/b13-10-/t9-,12-/m1/s1 |
| InChIKey | WWWRFMZVFNRLOC-SQLGNLQMSA-N |
| XLogP | 2.75 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|