C16H26N2O4 — CID 7173796
ethyl N-ethoxycarbonyl-N-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamate (PubChem CID 7173796) has the molecular formula C16H26N2O4 and a molecular weight of 310.39 g/mol. Its IUPAC name is ethyl N-ethoxycarbonyl-N-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamate.
| Compound Name | ethyl N-ethoxycarbonyl-N-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamate |
|---|---|
| PubChem CID | 7173796 |
| Molecular Formula | C16H26N2O4 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.19 |
| IUPAC Name | ethyl N-ethoxycarbonyl-N-[(Z)-[(1S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]carbamate |
| SMILES | CCOC(=O)N(/N=C1/C[C@@H]2CC[C@@]1(C)C2(C)C)C(=O)OCC |
| InChI | InChI=1S/C16H26N2O4/c1-6-21-13(19)18(14(20)22-7-2)17-12-10-11-8-9-16(12,5)15(11,3)4/h11H,6-10H2,1-5H3/b17-12-/t11-,16+/m0/s1 |
| InChIKey | DZXVJZZRYADWSG-RDTHRXSYSA-N |
| XLogP | 3.80 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|