C22H35NO6 — CID 177397757
diethyl 3-(1,3-dioxolan-4-yl)-2-[[(4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]pentanedioate (PubChem CID 177397757) has the molecular formula C22H35NO6 and a molecular weight of 409.52 g/mol. Its IUPAC name is diethyl 3-(1,3-dioxolan-4-yl)-2-[[(4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]pentanedioate.
| Compound Name | diethyl 3-(1,3-dioxolan-4-yl)-2-[[(4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]pentanedioate |
|---|---|
| PubChem CID | 177397757 |
| Molecular Formula | C22H35NO6 |
| Molecular Weight | 409.52 g/mol |
| Exact Mass | 409.25 |
| IUPAC Name | diethyl 3-(1,3-dioxolan-4-yl)-2-[[(4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]amino]pentanedioate |
| SMILES | CCOC(=O)CC(C1COCO1)C(/N=C1\C[C@H]2CCC1(C)C2(C)C)C(=O)OCC |
| InChI | InChI=1S/C22H35NO6/c1-6-27-18(24)11-15(16-12-26-13-29-16)19(20(25)28-7-2)23-17-10-14-8-9-22(17,5)21(14,3)4/h14-16,19H,6-13H2,1-5H3/b23-17+/t14-,15?,16?,19?,22?/m1/s1 |
| InChIKey | OKBSSKAQILCYDP-YILDEKQOSA-N |
| XLogP | 3.15 |
| TPSA | 83.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.52 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|