About (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane
(1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane (PubChem CID 162213995) has the molecular formula C11H18
and a molecular weight of 150.26 g/mol. Its IUPAC name is (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane.
Molecular Properties
| Compound Name | (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane |
| PubChem CID | 162213995 |
| Molecular Formula | C11H18 |
| Molecular Weight | 150.26 g/mol |
| Exact Mass | 150.14 |
| IUPAC Name | (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1CC2CC[C@@]1(C)C2(C)C |
| InChI | InChI=1S/C11H18/c1-8-7-9-5-6-11(8,4)10(9,2)3/h9H,1,5-7H2,2-4H3/t9?,11-/m1/s1 |
| InChIKey | ZASFWGOMAIPHLN-HCCKASOXSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.26 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane?
The IUPAC name of (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane (CID 162213995) is (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane.
What is the SMILES notation for (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane?
The canonical SMILES for (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane is C=C1CC2CC[C@@]1(C)C2(C)C.
What is the InChIKey of (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane?
The InChIKey is ZASFWGOMAIPHLN-HCCKASOXSA-N. The full InChI is InChI=1S/C11H18/c1-8-7-9-5-6-11(8,4)10(9,2)3/h9H,1,5-7H2,2-4H3/t9?,11-/m1/s1.
What are the key properties of (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane?
(1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane has a molecular weight of 150.26 g/mol, XLogP of 3.39, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,7,7-trimethyl-2-methylidenebicyclo[2.2.1]heptane is sourced from PubChem (CID 162213995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).