C14H24S — CID 101226517
(1S,4S)-1-tert-butylsulfanyl-7,7-dimethyl-2-methylidenebicyclo[2.2.1]heptane (PubChem CID 101226517) has the molecular formula C14H24S and a molecular weight of 224.41 g/mol. Its IUPAC name is (1S,4S)-1-tert-butylsulfanyl-7,7-dimethyl-2-methylidenebicyclo[2.2.1]heptane.
| Compound Name | (1S,4S)-1-tert-butylsulfanyl-7,7-dimethyl-2-methylidenebicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 101226517 |
| Molecular Formula | C14H24S |
| Molecular Weight | 224.41 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | (1S,4S)-1-tert-butylsulfanyl-7,7-dimethyl-2-methylidenebicyclo[2.2.1]heptane |
| SMILES | C=C1C[C@@H]2CC[C@@]1(SC(C)(C)C)C2(C)C |
| InChI | InChI=1S/C14H24S/c1-10-9-11-7-8-14(10,13(11,5)6)15-12(2,3)4/h11H,1,7-9H2,2-6H3/t11-,14-/m0/s1 |
| InChIKey | HGKDNSRIVLNYRW-FZMZJTMJSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|