About 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane
1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane (PubChem CID 166031080) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane.
Molecular Properties
| Compound Name | 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane |
| PubChem CID | 166031080 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane |
| SMILES | CC(C)(C)C12CCC(C1)C2(C)C |
| InChI | InChI=1S/C12H22/c1-10(2,3)12-7-6-9(8-12)11(12,4)5/h9H,6-8H2,1-5H3 |
| InChIKey | GGRMCPYXZMIBEE-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane?
The IUPAC name of 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane (CID 166031080) is 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane.
What is the SMILES notation for 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane?
The canonical SMILES for 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane is CC(C)(C)C12CCC(C1)C2(C)C.
What is the InChIKey of 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane?
The InChIKey is GGRMCPYXZMIBEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-10(2,3)12-7-6-9(8-12)11(12,4)5/h9H,6-8H2,1-5H3.
What are the key properties of 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane?
1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane has a molecular weight of 166.31 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-5,5-dimethylbicyclo[2.1.1]hexane is sourced from PubChem (CID 166031080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).