C19H30O2 — CID 100949250
(5R,9R)-1',7',7'-trimethylspiro[6,8-dioxatricyclo[7.3.0.01,5]dodecane-7,2'-bicyclo[2.2.1]heptane] (PubChem CID 100949250) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (5R,9R)-1',7',7'-trimethylspiro[6,8-dioxatricyclo[7.3.0.01,5]dodecane-7,2'-bicyclo[2.2.1]heptane].
| Compound Name | (5R,9R)-1',7',7'-trimethylspiro[6,8-dioxatricyclo[7.3.0.01,5]dodecane-7,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 100949250 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (5R,9R)-1',7',7'-trimethylspiro[6,8-dioxatricyclo[7.3.0.01,5]dodecane-7,2'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)C2CCC1(C)C1(C2)O[C@@H]2CCCC23CCC[C@H]3O1 |
| InChI | InChI=1S/C19H30O2/c1-16(2)13-8-11-17(16,3)19(12-13)20-14-6-4-9-18(14)10-5-7-15(18)21-19/h13-15H,4-12H2,1-3H3/t13?,14-,15-,17?,18?/m1/s1 |
| InChIKey | INQCJLCTCYNCBJ-GAHPPOBZSA-N |
| XLogP | 4.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |