C56H58O6 — CID 101169168
(3aR,4R,5S,6S,7R,7aS)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-trityloxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 101169168) has the molecular formula C56H58O6 and a molecular weight of 827.07 g/mol. Its IUPAC name is (3aR,4R,5S,6S,7R,7aS)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-trityloxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (3aR,4R,5S,6S,7R,7aS)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-trityloxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 101169168 |
| Molecular Formula | C56H58O6 |
| Molecular Weight | 827.07 g/mol |
| Exact Mass | 826.42 |
| IUPAC Name | (3aR,4R,5S,6S,7R,7aS)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-trityloxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)C2CCC1(C)C1(C2)O[C@@H]2[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OC(c3ccccc3)(c3ccccc3)c3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C56H58O6/c1-53(2)46-34-35-54(53,3)55(36-46)60-50-48(58-38-41-24-12-5-13-25-41)47(57-37-40-22-10-4-11-23-40)49(59-39-42-26-14-6-15-27-42)51(52(50)61-55)62-56(43-28-16-7-17-29-43,44-30-18-8-19-31-44)45-32-20-9-21-33-45/h4-33,46-52H,34-39H2,1-3H3/t46?,47-,48-,49+,50-,51-,52-,54?,55?/m1/s1 |
| InChIKey | JVLROLKEOWFDAH-YLQWOTNYSA-N |
| XLogP | 11.46 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.07 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|