C40H48O6 — CID 11422224
(1'R,3aS,4R,4'R,5S,6R,7R,7aR)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 11422224) has the molecular formula C40H48O6 and a molecular weight of 624.82 g/mol. Its IUPAC name is (1'R,3aS,4R,4'R,5S,6R,7R,7aR)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,3aS,4R,4'R,5S,6R,7R,7aR)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 11422224 |
| Molecular Formula | C40H48O6 |
| Molecular Weight | 624.82 g/mol |
| Exact Mass | 624.35 |
| IUPAC Name | (1'R,3aS,4R,4'R,5S,6R,7R,7aR)-1',7',7'-trimethyl-4,5,6-tris(phenylmethoxy)-7-prop-2-enoxyspiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | C=CCO[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2OC3(C[C@H]4CC[C@]3(C)C4(C)C)O[C@H]12 |
| InChI | InChI=1S/C40H48O6/c1-5-23-41-34-32(42-25-28-15-9-6-10-16-28)33(43-26-29-17-11-7-12-18-29)35(44-27-30-19-13-8-14-20-30)37-36(34)45-40(46-37)24-31-21-22-39(40,4)38(31,2)3/h5-20,31-37H,1,21-27H2,2-4H3/t31-,32+,33+,34-,35-,36-,37+,39-,40?/m1/s1 |
| InChIKey | ZPEJVPCTPHGOGQ-QCNYCZDUSA-N |
| XLogP | 7.65 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.82 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|