C28H38O6 — CID 11070711
(3aS,4R,5S,6S,7R,7aR)-4-phenylmethoxy-5,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] (PubChem CID 11070711) has the molecular formula C28H38O6 and a molecular weight of 470.61 g/mol. Its IUPAC name is (3aS,4R,5S,6S,7R,7aR)-4-phenylmethoxy-5,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane].
| Compound Name | (3aS,4R,5S,6S,7R,7aR)-4-phenylmethoxy-5,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] |
|---|---|
| PubChem CID | 11070711 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | (3aS,4R,5S,6S,7R,7aR)-4-phenylmethoxy-5,6,7-tris(prop-2-enoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,1'-cyclohexane] |
| SMILES | C=CCO[C@H]1[C@H](OCC=C)[C@@H](OCc2ccccc2)[C@@H]2OC3(CCCCC3)O[C@@H]2[C@@H]1OCC=C |
| InChI | InChI=1S/C28H38O6/c1-4-17-29-22-23(30-18-5-2)25(32-20-21-13-9-7-10-14-21)27-26(24(22)31-19-6-3)33-28(34-27)15-11-8-12-16-28/h4-7,9-10,13-14,22-27H,1-3,8,11-12,15-20H2/t22-,23-,24+,25+,26+,27-/m0/s1 |
| InChIKey | FOMUXNLJMVJJRS-TVNXAQAJSA-N |
| XLogP | 4.74 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|