C44H50O6 — CID 14505233
(1'R,3aR,4S,4'R,5R,6R,7S,7aS)-1',7',7'-trimethyl-4,5,6,7-tetrakis(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 14505233) has the molecular formula C44H50O6 and a molecular weight of 674.88 g/mol. Its IUPAC name is (1'R,3aR,4S,4'R,5R,6R,7S,7aS)-1',7',7'-trimethyl-4,5,6,7-tetrakis(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,3aR,4S,4'R,5R,6R,7S,7aS)-1',7',7'-trimethyl-4,5,6,7-tetrakis(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 14505233 |
| Molecular Formula | C44H50O6 |
| Molecular Weight | 674.88 g/mol |
| Exact Mass | 674.36 |
| IUPAC Name | (1'R,3aR,4S,4'R,5R,6R,7S,7aS)-1',7',7'-trimethyl-4,5,6,7-tetrakis(phenylmethoxy)spiro[3a,4,5,6,7,7a-hexahydro-1,3-benzodioxole-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)C1(C2)O[C@@H]2[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C44H50O6/c1-42(2)35-24-25-43(42,3)44(26-35)49-40-38(47-29-33-20-12-6-13-21-33)36(45-27-31-16-8-4-9-17-31)37(46-28-32-18-10-5-11-19-32)39(41(40)50-44)48-30-34-22-14-7-15-23-34/h4-23,35-41H,24-30H2,1-3H3/t35-,36-,37-,38+,39+,40-,41+,43-,44?/m1/s1 |
| InChIKey | XAKCCKGUPINANN-FMNPKSTOSA-N |
| XLogP | 8.67 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.88 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |