C14H24O2 — CID 98573353
(1'R,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] (PubChem CID 98573353) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is (1'R,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane].
| Compound Name | (1'R,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
|---|---|
| PubChem CID | 98573353 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | (1'R,4R,4'S,5S)-1',4,5,7',7'-pentamethylspiro[1,3-dioxolane-2,2'-bicyclo[2.2.1]heptane] |
| SMILES | C[C@@H]1OC2(C[C@@H]3CC[C@]2(C)C3(C)C)O[C@@H]1C |
| InChI | InChI=1S/C14H24O2/c1-9-10(2)16-14(15-9)8-11-6-7-13(14,5)12(11,3)4/h9-11H,6-8H2,1-5H3/t9-,10+,11-,13+,14?/m0/s1 |
| InChIKey | BKDJZRSRCQULOM-YJWVNASPSA-N |
| XLogP | 3.35 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |