C32H44O4Si — CID 176589523
CID 176589523 (PubChem CID 176589523) has the molecular formula C32H44O4Si and a molecular weight of 520.79 g/mol.
| Compound Name | CID 176589523 |
|---|---|
| PubChem CID | 176589523 |
| Molecular Formula | C32H44O4Si |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.30 |
| IUPAC Name | — |
| SMILES | CC1(C)C2CCC1(C)C1(C2)OO[C@@]2(CCC[C@@H](O[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)C2)O1 |
| InChI | InChI=1S/C32H44O4Si/c1-28(2,3)37(26-15-9-7-10-16-26,27-17-11-8-12-18-27)33-25-14-13-20-31(23-25)34-32(36-35-31)22-24-19-21-30(32,6)29(24,4)5/h7-12,15-18,24-25H,13-14,19-23H2,1-6H3/t24?,25-,30?,31-,32?/m1/s1 |
| InChIKey | AVTMFPQERUWDGB-RZYVWLROSA-N |
| XLogP | 6.72 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|