C30H40O4Si — CID 176589524
CID 176589524 (PubChem CID 176589524) has the molecular formula C30H40O4Si and a molecular weight of 492.73 g/mol.
| Compound Name | CID 176589524 |
|---|---|
| PubChem CID | 176589524 |
| Molecular Formula | C30H40O4Si |
| Molecular Weight | 492.73 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | — |
| SMILES | CC(C)(C)[Si](O[C@@H]1CCC[C@]2(C1)OOC1(CC3CCC1CC3)O2)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H40O4Si/c1-28(2,3)35(26-12-6-4-7-13-26,27-14-8-5-9-15-27)31-25-11-10-20-29(22-25)32-30(34-33-29)21-23-16-18-24(30)19-17-23/h4-9,12-15,23-25H,10-11,16-22H2,1-3H3/t23?,24?,25-,29-,30?/m1/s1 |
| InChIKey | ZCOBVMUZMKQLFY-GQQWQPKHSA-N |
| XLogP | 6.09 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|