C27H36O2Si — CID 173098272
[(3R,5S)-3-[tert-butyl(diphenyl)silyl]oxyspiro[4.5]dec-9-en-9-yl]methanol (PubChem CID 173098272) has the molecular formula C27H36O2Si and a molecular weight of 420.67 g/mol. Its IUPAC name is [(3R,5S)-3-[tert-butyl(diphenyl)silyl]oxyspiro[4.5]dec-9-en-9-yl]methanol.
| Compound Name | [(3R,5S)-3-[tert-butyl(diphenyl)silyl]oxyspiro[4.5]dec-9-en-9-yl]methanol |
|---|---|
| PubChem CID | 173098272 |
| Molecular Formula | C27H36O2Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(3R,5S)-3-[tert-butyl(diphenyl)silyl]oxyspiro[4.5]dec-9-en-9-yl]methanol |
| SMILES | CC(C)(C)[Si](O[C@@H]1CC[C@]2(C=C(CO)CCC2)C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H36O2Si/c1-26(2,3)30(24-12-6-4-7-13-24,25-14-8-5-9-15-25)29-23-16-18-27(20-23)17-10-11-22(19-27)21-28/h4-9,12-15,19,23,28H,10-11,16-18,20-21H2,1-3H3/t23-,27-/m1/s1 |
| InChIKey | YUOLHANAVLSKOT-YIXXDRMTSA-N |
| XLogP | 5.20 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|