C25H31NO2Si — CID 171719073
1-[3-[tert-butyl(diphenyl)silyl]oxy-1-methylcyclopentyl]-2-isocyanoethanone (PubChem CID 171719073) has the molecular formula C25H31NO2Si and a molecular weight of 405.61 g/mol. Its IUPAC name is 1-[3-[tert-butyl(diphenyl)silyl]oxy-1-methylcyclopentyl]-2-isocyanoethanone.
| Compound Name | 1-[3-[tert-butyl(diphenyl)silyl]oxy-1-methylcyclopentyl]-2-isocyanoethanone |
|---|---|
| PubChem CID | 171719073 |
| Molecular Formula | C25H31NO2Si |
| Molecular Weight | 405.61 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | 1-[3-[tert-butyl(diphenyl)silyl]oxy-1-methylcyclopentyl]-2-isocyanoethanone |
| SMILES | [C-]#[N+]CC(=O)C1(C)CCC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H31NO2Si/c1-24(2,3)29(21-12-8-6-9-13-21,22-14-10-7-11-15-22)28-20-16-17-25(4,18-20)23(27)19-26-5/h6-15,20H,16-19H2,1-4H3 |
| InChIKey | QAQDHFFJEOLAFQ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 30.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|