C10H17Br3OSi — CID 141126262
1,7,7-trimethyl-2-tribromosilylbicyclo[2.2.1]heptan-2-ol (PubChem CID 141126262) has the molecular formula C10H17Br3OSi and a molecular weight of 421.04 g/mol. Its IUPAC name is 1,7,7-trimethyl-2-tribromosilylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 1,7,7-trimethyl-2-tribromosilylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 141126262 |
| Molecular Formula | C10H17Br3OSi |
| Molecular Weight | 421.04 g/mol |
| Exact Mass | 417.86 |
| IUPAC Name | 1,7,7-trimethyl-2-tribromosilylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(C)C(O)([Si](Br)(Br)Br)C2 |
| InChI | InChI=1S/C10H17Br3OSi/c1-8(2)7-4-5-9(8,3)10(14,6-7)15(11,12)13/h7,14H,4-6H2,1-3H3 |
| InChIKey | LRPIUDKYLBEVRT-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.04 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|