C20H32O — CID 141298497
2-(1-adamantyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 141298497) has the molecular formula C20H32O and a molecular weight of 288.47 g/mol. Its IUPAC name is 2-(1-adamantyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | 2-(1-adamantyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 141298497 |
| Molecular Formula | C20H32O |
| Molecular Weight | 288.47 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | 2-(1-adamantyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)C2CCC1(C)C(O)(C13CC4CC(CC(C4)C1)C3)C2 |
| InChI | InChI=1S/C20H32O/c1-17(2)16-4-5-18(17,3)20(21,12-16)19-9-13-6-14(10-19)8-15(7-13)11-19/h13-16,21H,4-12H2,1-3H3 |
| InChIKey | DSGVGBBENDAIFO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.47 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |