C8H10Cl4 — CID 54000312
1,2,2,3-tetrachloro-3-methylbicyclo[2.2.1]heptane (PubChem CID 54000312) has the molecular formula C8H10Cl4 and a molecular weight of 247.98 g/mol. Its IUPAC name is 1,2,2,3-tetrachloro-3-methylbicyclo[2.2.1]heptane.
| Compound Name | 1,2,2,3-tetrachloro-3-methylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 54000312 |
| Molecular Formula | C8H10Cl4 |
| Molecular Weight | 247.98 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 1,2,2,3-tetrachloro-3-methylbicyclo[2.2.1]heptane |
| SMILES | CC1(Cl)C2CCC(Cl)(C2)C1(Cl)Cl |
| InChI | InChI=1S/C8H10Cl4/c1-6(9)5-2-3-7(10,4-5)8(6,11)12/h5H,2-4H2,1H3 |
| InChIKey | KLCJFTBWZMPSIC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.98 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|