C9H17ClSi — CID 172778612
chloro-(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)silane (PubChem CID 172778612) has the molecular formula C9H17ClSi and a molecular weight of 188.77 g/mol. Its IUPAC name is chloro-(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)silane.
| Compound Name | chloro-(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)silane |
|---|---|
| PubChem CID | 172778612 |
| Molecular Formula | C9H17ClSi |
| Molecular Weight | 188.77 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | chloro-(7,7-dimethyl-1-bicyclo[2.2.1]heptanyl)silane |
| SMILES | CC1(C)C2CCC1([SiH2]Cl)CC2 |
| InChI | InChI=1S/C9H17ClSi/c1-8(2)7-3-5-9(8,11-10)6-4-7/h7H,3-6,11H2,1-2H3 |
| InChIKey | NYFWYPKOSVEHMN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.77 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|