C10H24O8P2 — CID 87142437
phosphoric acid;1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 87142437) has the molecular formula C10H24O8P2 and a molecular weight of 334.24 g/mol. Its IUPAC name is phosphoric acid;1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | phosphoric acid;1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 87142437 |
| Molecular Formula | C10H24O8P2 |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | phosphoric acid;1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | CC12CCC(CC1)C2(C)C.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C10H18.2H3O4P/c1-9(2)8-4-6-10(9,3)7-5-8;2*1-5(2,3)4/h8H,4-7H2,1-3H3;2*(H3,1,2,3,4) |
| InChIKey | RNVVGOCKCJVXBL-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 155.52 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|