C13H27N3O2 — CID 174415589
acetic acid;guanidine;1,7,7-trimethylbicyclo[2.2.1]heptane (PubChem CID 174415589) has the molecular formula C13H27N3O2 and a molecular weight of 257.38 g/mol. Its IUPAC name is acetic acid;guanidine;1,7,7-trimethylbicyclo[2.2.1]heptane.
| Compound Name | acetic acid;guanidine;1,7,7-trimethylbicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 174415589 |
| Molecular Formula | C13H27N3O2 |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | acetic acid;guanidine;1,7,7-trimethylbicyclo[2.2.1]heptane |
| SMILES | CC(=O)O.CC12CCC(CC1)C2(C)C.[H]N=C(N)N |
| InChI | InChI=1S/C10H18.C2H4O2.CH5N3/c1-9(2)8-4-6-10(9,3)7-5-8;1-2(3)4;2-1(3)4/h8H,4-7H2,1-3H3;1H3,(H,3,4);(H5,2,3,4) |
| InChIKey | UGBCLICXBPDAGE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 113.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|