C17H28O2 — CID 45139470
(E)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,4-dimethylpent-2-en-1-one (PubChem CID 45139470) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (E)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,4-dimethylpent-2-en-1-one.
| Compound Name | (E)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,4-dimethylpent-2-en-1-one |
|---|---|
| PubChem CID | 45139470 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (E)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4,4-dimethylpent-2-en-1-one |
| SMILES | CC(C)(C)/C=C/C(=O)[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H28O2/c1-14(2,3)9-8-13(18)17(19)11-12-7-10-16(17,6)15(12,4)5/h8-9,12,19H,7,10-11H2,1-6H3/b9-8+/t12-,16-,17+/m1/s1 |
| InChIKey | RBXJDJAAJDNTHP-YLJUUEQCSA-N |
| XLogP | 3.74 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|