C27H54O4Si2 — CID 10973128
(3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pentan-1-one (PubChem CID 10973128) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pentan-1-one.
| Compound Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pentan-1-one |
|---|---|
| PubChem CID | 10973128 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | (3R,4S)-3,4-bis[[tert-butyl(dimethyl)silyl]oxy]-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]pentan-1-one |
| SMILES | C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CC(=O)[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H54O4Si2/c1-19(30-32(11,12)23(2,3)4)21(31-33(13,14)24(5,6)7)17-22(28)27(29)18-20-15-16-26(27,10)25(20,8)9/h19-21,29H,15-18H2,1-14H3/t19-,20+,21+,26+,27-/m0/s1 |
| InChIKey | VIMJHXCFTBXLQX-YZNATHFASA-N |
| XLogP | 7.32 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|