C17H28O3 — CID 10636493
[(2S,3S)-3-butyloxiran-2-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone (PubChem CID 10636493) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(2S,3S)-3-butyloxiran-2-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone.
| Compound Name | [(2S,3S)-3-butyloxiran-2-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
|---|---|
| PubChem CID | 10636493 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(2S,3S)-3-butyloxiran-2-yl]-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]methanone |
| SMILES | CCCC[C@@H]1O[C@@H]1C(=O)[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C17H28O3/c1-5-6-7-12-13(20-12)14(18)17(19)10-11-8-9-16(17,4)15(11,2)3/h11-13,19H,5-10H2,1-4H3/t11-,12+,13+,16-,17+/m1/s1 |
| InChIKey | DPLADCDQVSRDNE-HVCLXXKLSA-N |
| XLogP | 3.09 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|