C32H48O3 — CID 141078512
[(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate (PubChem CID 141078512) has the molecular formula C32H48O3 and a molecular weight of 480.73 g/mol. Its IUPAC name is [(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | [(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 141078512 |
| Molecular Formula | C32H48O3 |
| Molecular Weight | 480.73 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | [(1R,2S,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] (2E,4E,6E,8E,10E,12E)-docosa-2,4,6,8,10,12-hexaenoate |
| SMILES | CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)O[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C32H48O3/c1-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-29(33)35-32(34)27-28-25-26-31(32,4)30(28,2)3/h13-24,28,34H,5-12,25-27H2,1-4H3/b14-13+,16-15+,18-17+,20-19+,22-21+,24-23+/t28-,31-,32+/m1/s1 |
| InChIKey | PIAVCQYVLLMIET-QDLZDSQUSA-N |
| XLogP | 8.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.73 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|