C35H43NO3 — CID 11800246
(3R,4R)-4-(dibenzylamino)-3-hydroxy-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-phenylpentan-1-one (PubChem CID 11800246) has the molecular formula C35H43NO3 and a molecular weight of 525.73 g/mol. Its IUPAC name is (3R,4R)-4-(dibenzylamino)-3-hydroxy-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-phenylpentan-1-one.
| Compound Name | (3R,4R)-4-(dibenzylamino)-3-hydroxy-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-phenylpentan-1-one |
|---|---|
| PubChem CID | 11800246 |
| Molecular Formula | C35H43NO3 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.32 |
| IUPAC Name | (3R,4R)-4-(dibenzylamino)-3-hydroxy-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-phenylpentan-1-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(C(=O)C[C@@H](O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1)C2 |
| InChI | InChI=1S/C35H43NO3/c1-33(2)29-19-20-34(33,3)35(39,23-29)32(38)22-31(37)30(21-26-13-7-4-8-14-26)36(24-27-15-9-5-10-16-27)25-28-17-11-6-12-18-28/h4-18,29-31,37,39H,19-25H2,1-3H3/t29-,30-,31-,34-,35+/m1/s1 |
| InChIKey | PISWBDXDEPSWSU-GBAKICNYSA-N |
| XLogP | 6.20 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |