C29H47NO5Si — CID 11352869
benzyl N-[(3S,4R)-4-hydroxy-2-methyl-6-oxo-6-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]hexan-3-yl]-N-methylcarbamate (PubChem CID 11352869) has the molecular formula C29H47NO5Si and a molecular weight of 517.78 g/mol. Its IUPAC name is benzyl N-[(3S,4R)-4-hydroxy-2-methyl-6-oxo-6-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]hexan-3-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(3S,4R)-4-hydroxy-2-methyl-6-oxo-6-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]hexan-3-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 11352869 |
| Molecular Formula | C29H47NO5Si |
| Molecular Weight | 517.78 g/mol |
| Exact Mass | 517.32 |
| IUPAC Name | benzyl N-[(3S,4R)-4-hydroxy-2-methyl-6-oxo-6-[(1R,2R,4R)-1,7,7-trimethyl-2-trimethylsilyloxy-2-bicyclo[2.2.1]heptanyl]hexan-3-yl]-N-methylcarbamate |
| SMILES | CC(C)[C@@H]([C@H](O)CC(=O)[C@@]1(O[Si](C)(C)C)C[C@H]2CC[C@]1(C)C2(C)C)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H47NO5Si/c1-20(2)25(30(6)26(33)34-19-21-13-11-10-12-14-21)23(31)17-24(32)29(35-36(7,8)9)18-22-15-16-28(29,5)27(22,3)4/h10-14,20,22-23,25,31H,15-19H2,1-9H3/t22-,23-,25+,28-,29+/m1/s1 |
| InChIKey | WXFREVRZMPDTSA-QENIFHOFSA-N |
| XLogP | 6.04 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.78 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|