C34H47NO5 — CID 11295801
(2S)-N-[(2S,3R)-3-hydroxy-5-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-oxo-1-phenylpentan-2-yl]-N,3-dimethyl-2-phenylmethoxybutanamide (PubChem CID 11295801) has the molecular formula C34H47NO5 and a molecular weight of 549.75 g/mol. Its IUPAC name is (2S)-N-[(2S,3R)-3-hydroxy-5-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-oxo-1-phenylpentan-2-yl]-N,3-dimethyl-2-phenylmethoxybutanamide.
| Compound Name | (2S)-N-[(2S,3R)-3-hydroxy-5-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-oxo-1-phenylpentan-2-yl]-N,3-dimethyl-2-phenylmethoxybutanamide |
|---|---|
| PubChem CID | 11295801 |
| Molecular Formula | C34H47NO5 |
| Molecular Weight | 549.75 g/mol |
| Exact Mass | 549.35 |
| IUPAC Name | (2S)-N-[(2S,3R)-3-hydroxy-5-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-5-oxo-1-phenylpentan-2-yl]-N,3-dimethyl-2-phenylmethoxybutanamide |
| SMILES | CC(C)[C@H](OCc1ccccc1)C(=O)N(C)[C@@H](Cc1ccccc1)[C@H](O)CC(=O)[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C |
| InChI | InChI=1S/C34H47NO5/c1-23(2)30(40-22-25-15-11-8-12-16-25)31(38)35(6)27(19-24-13-9-7-10-14-24)28(36)20-29(37)34(39)21-26-17-18-33(34,5)32(26,3)4/h7-16,23,26-28,30,36,39H,17-22H2,1-6H3/t26-,27+,28-,30+,33-,34+/m1/s1 |
| InChIKey | HAVVRBSIRLNZLH-VDXIRXOUSA-N |
| XLogP | 5.19 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.75 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |