C21H29NO4 — CID 102418204
(3S,4S)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4-nitro-3-phenylpentan-1-one (PubChem CID 102418204) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (3S,4S)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4-nitro-3-phenylpentan-1-one.
| Compound Name | (3S,4S)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4-nitro-3-phenylpentan-1-one |
|---|---|
| PubChem CID | 102418204 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (3S,4S)-1-[(1R,2R,4R)-2-hydroxy-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-4-nitro-3-phenylpentan-1-one |
| SMILES | C[C@@H]([C@@H](CC(=O)[C@@]1(O)C[C@H]2CC[C@]1(C)C2(C)C)c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C21H29NO4/c1-14(22(25)26)17(15-8-6-5-7-9-15)12-18(23)21(24)13-16-10-11-20(21,4)19(16,2)3/h5-9,14,16-17,24H,10-13H2,1-4H3/t14-,16+,17+,20+,21-/m0/s1 |
| InChIKey | ZUIZFHVEVWKFPB-UULNXAQQSA-N |
| XLogP | 3.97 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|